C7H11ClN4O — CID 63330181
2-chloro-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]acetamide (PubChem CID 63330181) has the molecular formula C7H11ClN4O and a molecular weight of 202.64 g/mol. Its IUPAC name is 2-chloro-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]acetamide.
| Compound Name | 2-chloro-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 63330181 |
| Molecular Formula | C7H11ClN4O |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 2-chloro-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]acetamide |
| SMILES | Cn1cnnc1CCNC(=O)CCl |
| InChI | InChI=1S/C7H11ClN4O/c1-12-5-10-11-6(12)2-3-9-7(13)4-8/h5H,2-4H2,1H3,(H,9,13) |
| InChIKey | UJFUDUATUNHGFA-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|