C9H14N4O3 — CID 63330652
ethyl 2-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]-2-oxoacetate (PubChem CID 63330652) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is ethyl 2-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]-2-oxoacetate.
| Compound Name | ethyl 2-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 63330652 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | ethyl 2-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NCCc1nncn1C |
| InChI | InChI=1S/C9H14N4O3/c1-3-16-9(15)8(14)10-5-4-7-12-11-6-13(7)2/h6H,3-5H2,1-2H3,(H,10,14) |
| InChIKey | ZWAFFELPDDWXBJ-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|