C11H21N5O — CID 55201136
N-butyl-2-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]acetamide (PubChem CID 55201136) has the molecular formula C11H21N5O and a molecular weight of 239.32 g/mol. Its IUPAC name is N-butyl-2-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]acetamide.
| Compound Name | N-butyl-2-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]acetamide |
|---|---|
| PubChem CID | 55201136 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N-butyl-2-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]acetamide |
| SMILES | CCCCNC(=O)CNCCc1nncn1C |
| InChI | InChI=1S/C11H21N5O/c1-3-4-6-13-11(17)8-12-7-5-10-15-14-9-16(10)2/h9,12H,3-8H2,1-2H3,(H,13,17) |
| InChIKey | UPEUHWGORBIIOR-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|