C7H13N5O — CID 116655956
1-methyl-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]urea (PubChem CID 116655956) has the molecular formula C7H13N5O and a molecular weight of 183.22 g/mol. Its IUPAC name is 1-methyl-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]urea.
| Compound Name | 1-methyl-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 116655956 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 1-methyl-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]urea |
| SMILES | CNC(=O)NCCc1nncn1C |
| InChI | InChI=1S/C7H13N5O/c1-8-7(13)9-4-3-6-11-10-5-12(6)2/h5H,3-4H2,1-2H3,(H2,8,9,13) |
| InChIKey | SVVIDRUHYGURAV-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |