C8H15N5S — CID 116508555
1-ethyl-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]thiourea (PubChem CID 116508555) has the molecular formula C8H15N5S and a molecular weight of 213.31 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]thiourea.
| Compound Name | 1-ethyl-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 116508555 |
| Molecular Formula | C8H15N5S |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 1-ethyl-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]thiourea |
| SMILES | CCNC(=S)NCCc1nncn1C |
| InChI | InChI=1S/C8H15N5S/c1-3-9-8(14)10-5-4-7-12-11-6-13(7)2/h6H,3-5H2,1-2H3,(H2,9,10,14) |
| InChIKey | DNSOESUOZCFHDY-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|