C11H15N7O — CID 63330662
6-hydrazinyl-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyridine-3-carboxamide (PubChem CID 63330662) has the molecular formula C11H15N7O and a molecular weight of 261.29 g/mol. Its IUPAC name is 6-hydrazinyl-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyridine-3-carboxamide.
| Compound Name | 6-hydrazinyl-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 63330662 |
| Molecular Formula | C11H15N7O |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 6-hydrazinyl-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyridine-3-carboxamide |
| SMILES | Cn1cnnc1CCNC(=O)c1ccc(NN)nc1 |
| InChI | InChI=1S/C11H15N7O/c1-18-7-15-17-10(18)4-5-13-11(19)8-2-3-9(16-12)14-6-8/h2-3,6-7H,4-5,12H2,1H3,(H,13,19)(H,14,16) |
| InChIKey | NZIBRDUMGYDVDT-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|