C11H21N7 — CID 104887608
1-amino-3-cyclopentyl-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]guanidine (PubChem CID 104887608) has the molecular formula C11H21N7 and a molecular weight of 251.34 g/mol. Its IUPAC name is 1-amino-3-cyclopentyl-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]guanidine.
| Compound Name | 1-amino-3-cyclopentyl-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 104887608 |
| Molecular Formula | C11H21N7 |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 1-amino-3-cyclopentyl-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]guanidine |
| SMILES | Cn1cnc(CC/N=C(\NN)NC2CCCC2)n1 |
| InChI | InChI=1S/C11H21N7/c1-18-8-14-10(17-18)6-7-13-11(16-12)15-9-4-2-3-5-9/h8-9H,2-7,12H2,1H3,(H2,13,15,16) |
| InChIKey | GIBHJVVJWVTYMH-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|