C13H24N4 — CID 80681774
N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]cyclooctanamine (PubChem CID 80681774) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]cyclooctanamine.
| Compound Name | N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]cyclooctanamine |
|---|---|
| PubChem CID | 80681774 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]cyclooctanamine |
| SMILES | Cn1cnc(CCNC2CCCCCCC2)n1 |
| InChI | InChI=1S/C13H24N4/c1-17-11-15-13(16-17)9-10-14-12-7-5-3-2-4-6-8-12/h11-12,14H,2-10H2,1H3 |
| InChIKey | MRLDKGXQUXQLNH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |