C12H23N3 — CID 3709064
1-butyl-5-hexyl-1,2,4-triazole (PubChem CID 3709064) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 1-butyl-5-hexyl-1,2,4-triazole.
| Compound Name | 1-butyl-5-hexyl-1,2,4-triazole |
|---|---|
| PubChem CID | 3709064 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 1-butyl-5-hexyl-1,2,4-triazole |
| SMILES | CCCCCCc1ncnn1CCCC |
| InChI | InChI=1S/C12H23N3/c1-3-5-7-8-9-12-13-11-14-15(12)10-6-4-2/h11H,3-10H2,1-2H3 |
| InChIKey | AVHUAPMJTFWYME-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|