C14H20Cl2N4 — CID 116512213
1-amino-3-cyclopentyl-2-[2-(2,4-dichlorophenyl)ethyl]guanidine (PubChem CID 116512213) has the molecular formula C14H20Cl2N4 and a molecular weight of 315.25 g/mol. Its IUPAC name is 1-amino-3-cyclopentyl-2-[2-(2,4-dichlorophenyl)ethyl]guanidine.
| Compound Name | 1-amino-3-cyclopentyl-2-[2-(2,4-dichlorophenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 116512213 |
| Molecular Formula | C14H20Cl2N4 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 1-amino-3-cyclopentyl-2-[2-(2,4-dichlorophenyl)ethyl]guanidine |
| SMILES | NN/C(=N\CCc1ccc(Cl)cc1Cl)NC1CCCC1 |
| InChI | InChI=1S/C14H20Cl2N4/c15-11-6-5-10(13(16)9-11)7-8-18-14(20-17)19-12-3-1-2-4-12/h5-6,9,12H,1-4,7-8,17H2,(H2,18,19,20) |
| InChIKey | ZWSCSMPRADRBQH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|