C11H20N6 — CID 116516539
1-amino-3-cyclopentyl-2-[2-(1H-imidazol-2-yl)ethyl]guanidine (PubChem CID 116516539) has the molecular formula C11H20N6 and a molecular weight of 236.32 g/mol. Its IUPAC name is 1-amino-3-cyclopentyl-2-[2-(1H-imidazol-2-yl)ethyl]guanidine.
| Compound Name | 1-amino-3-cyclopentyl-2-[2-(1H-imidazol-2-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 116516539 |
| Molecular Formula | C11H20N6 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | 1-amino-3-cyclopentyl-2-[2-(1H-imidazol-2-yl)ethyl]guanidine |
| SMILES | NN/C(=N\CCc1ncc[nH]1)NC1CCCC1 |
| InChI | InChI=1S/C11H20N6/c12-17-11(16-9-3-1-2-4-9)15-6-5-10-13-7-8-14-10/h7-9H,1-6,12H2,(H,13,14)(H2,15,16,17) |
| InChIKey | VFRPMAJTHWUKKR-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|