C9H14N4S — CID 116510338
1-cyclopropyl-3-[2-(1H-imidazol-2-yl)ethyl]thiourea (PubChem CID 116510338) has the molecular formula C9H14N4S and a molecular weight of 210.31 g/mol. Its IUPAC name is 1-cyclopropyl-3-[2-(1H-imidazol-2-yl)ethyl]thiourea.
| Compound Name | 1-cyclopropyl-3-[2-(1H-imidazol-2-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 116510338 |
| Molecular Formula | C9H14N4S |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 1-cyclopropyl-3-[2-(1H-imidazol-2-yl)ethyl]thiourea |
| SMILES | S=C(NCCc1ncc[nH]1)NC1CC1 |
| InChI | InChI=1S/C9H14N4S/c14-9(13-7-1-2-7)12-4-3-8-10-5-6-11-8/h5-7H,1-4H2,(H,10,11)(H2,12,13,14) |
| InChIKey | XJGMVJQKSNSCDU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|