C11H17N3S2 — CID 116508515
1-cyclopentyl-3-[2-(1,3-thiazol-2-yl)ethyl]thiourea (PubChem CID 116508515) has the molecular formula C11H17N3S2 and a molecular weight of 255.41 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-(1,3-thiazol-2-yl)ethyl]thiourea.
| Compound Name | 1-cyclopentyl-3-[2-(1,3-thiazol-2-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 116508515 |
| Molecular Formula | C11H17N3S2 |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 1-cyclopentyl-3-[2-(1,3-thiazol-2-yl)ethyl]thiourea |
| SMILES | S=C(NCCc1nccs1)NC1CCCC1 |
| InChI | InChI=1S/C11H17N3S2/c15-11(14-9-3-1-2-4-9)13-6-5-10-12-7-8-16-10/h7-9H,1-6H2,(H2,13,14,15) |
| InChIKey | BSOVHJSYACSAON-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|