C19H36N4S2 — CID 131972523
1-cyclohexyl-3-[5-(cyclohexylcarbamothioylamino)pentyl]thiourea (PubChem CID 131972523) has the molecular formula C19H36N4S2 and a molecular weight of 384.66 g/mol. Its IUPAC name is 1-cyclohexyl-3-[5-(cyclohexylcarbamothioylamino)pentyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[5-(cyclohexylcarbamothioylamino)pentyl]thiourea |
|---|---|
| PubChem CID | 131972523 |
| Molecular Formula | C19H36N4S2 |
| Molecular Weight | 384.66 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 1-cyclohexyl-3-[5-(cyclohexylcarbamothioylamino)pentyl]thiourea |
| SMILES | S=C(NCCCCCNC(=S)NC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C19H36N4S2/c24-18(22-16-10-4-1-5-11-16)20-14-8-3-9-15-21-19(25)23-17-12-6-2-7-13-17/h16-17H,1-15H2,(H2,20,22,24)(H2,21,23,25) |
| InChIKey | HCMHXYNAUOIUDO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.66 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|