C21H37N3OS — CID 87153919
1-[5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-oxopentyl]-3-cyclohexylthiourea (PubChem CID 87153919) has the molecular formula C21H37N3OS and a molecular weight of 379.61 g/mol. Its IUPAC name is 1-[5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-oxopentyl]-3-cyclohexylthiourea.
| Compound Name | 1-[5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-oxopentyl]-3-cyclohexylthiourea |
|---|---|
| PubChem CID | 87153919 |
| Molecular Formula | C21H37N3OS |
| Molecular Weight | 379.61 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | 1-[5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-oxopentyl]-3-cyclohexylthiourea |
| SMILES | O=C(CCCCNC(=S)NC1CCCCC1)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C21H37N3OS/c25-20(24-16-8-10-17-9-4-5-13-19(17)24)14-6-7-15-22-21(26)23-18-11-2-1-3-12-18/h17-19H,1-16H2,(H2,22,23,26) |
| InChIKey | IYCHHAYGHQGVDT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.61 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|