C19H35N3OS — CID 87154002
1-[5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-oxopentyl]-3-tert-butylthiourea (PubChem CID 87154002) has the molecular formula C19H35N3OS and a molecular weight of 353.58 g/mol. Its IUPAC name is 1-[5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-oxopentyl]-3-tert-butylthiourea.
| Compound Name | 1-[5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-oxopentyl]-3-tert-butylthiourea |
|---|---|
| PubChem CID | 87154002 |
| Molecular Formula | C19H35N3OS |
| Molecular Weight | 353.58 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 1-[5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-oxopentyl]-3-tert-butylthiourea |
| SMILES | CC(C)(C)NC(=S)NCCCCC(=O)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C19H35N3OS/c1-19(2,3)21-18(24)20-13-7-6-12-17(23)22-14-8-10-15-9-4-5-11-16(15)22/h15-16H,4-14H2,1-3H3,(H2,20,21,24) |
| InChIKey | JFTTZPBRCOBMRJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|