C11H18N4OS — CID 106395713
1-cyclohexyl-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]thiourea (PubChem CID 106395713) has the molecular formula C11H18N4OS and a molecular weight of 254.36 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 106395713 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-cyclohexyl-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]thiourea |
| SMILES | S=C(NCCc1ncno1)NC1CCCCC1 |
| InChI | InChI=1S/C11H18N4OS/c17-11(15-9-4-2-1-3-5-9)12-7-6-10-13-8-14-16-10/h8-9H,1-7H2,(H2,12,15,17) |
| InChIKey | XUMRRIKEDOFVEM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|