C10H17N3O2 — CID 106400144
2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]cyclohexan-1-ol (PubChem CID 106400144) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]cyclohexan-1-ol.
| Compound Name | 2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 106400144 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]cyclohexan-1-ol |
| SMILES | OC1CCCCC1NCCc1ncno1 |
| InChI | InChI=1S/C10H17N3O2/c14-9-4-2-1-3-8(9)11-6-5-10-12-7-13-15-10/h7-9,11,14H,1-6H2 |
| InChIKey | QUPUDUPDYZCOOB-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |