C7H16N2O — CID 55289731
trans-(1R,2R)-2-(2-aminoethylamino)cyclopentan-1-ol (PubChem CID 55289731) has the molecular formula C7H16N2O and a molecular weight of 144.22 g/mol. Its IUPAC name is trans-(1R,2R)-2-(2-aminoethylamino)cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-(2-aminoethylamino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 55289731 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | trans-(1R,2R)-2-(2-aminoethylamino)cyclopentan-1-ol |
| SMILES | NCCN[C@@H]1CCC[C@H]1O |
| InChI | InChI=1S/C7H16N2O/c8-4-5-9-6-2-1-3-7(6)10/h6-7,9-10H,1-5,8H2/t6-,7-/m1/s1 |
| InChIKey | JLLCOSVCJLDMHE-RNFRBKRXSA-N |
| XLogP | -0.55 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |