C9H18N2O2 — CID 102733144
4-[[(1S,2S)-2-hydroxycyclopentyl]amino]butanamide (PubChem CID 102733144) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 4-[[(1S,2S)-2-hydroxycyclopentyl]amino]butanamide.
| Compound Name | 4-[[(1S,2S)-2-hydroxycyclopentyl]amino]butanamide |
|---|---|
| PubChem CID | 102733144 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 4-[[(1S,2S)-2-hydroxycyclopentyl]amino]butanamide |
| SMILES | NC(=O)CCCN[C@H]1CCC[C@@H]1O |
| InChI | InChI=1S/C9H18N2O2/c10-9(13)5-2-6-11-7-3-1-4-8(7)12/h7-8,11-12H,1-6H2,(H2,10,13)/t7-,8-/m0/s1 |
| InChIKey | BNPGUCDFNYBLPN-YUMQZZPRSA-N |
| XLogP | -0.25 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|