C9H19NO3S — CID 93451298
trans-(1R,2R)-2-(3-methylsulfonylpropylamino)cyclopentan-1-ol (PubChem CID 93451298) has the molecular formula C9H19NO3S and a molecular weight of 221.32 g/mol. Its IUPAC name is trans-(1R,2R)-2-(3-methylsulfonylpropylamino)cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-(3-methylsulfonylpropylamino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 93451298 |
| Molecular Formula | C9H19NO3S |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | trans-(1R,2R)-2-(3-methylsulfonylpropylamino)cyclopentan-1-ol |
| SMILES | CS(=O)(=O)CCCN[C@@H]1CCC[C@H]1O |
| InChI | InChI=1S/C9H19NO3S/c1-14(12,13)7-3-6-10-8-4-2-5-9(8)11/h8-11H,2-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | JZAANXWGPRBPAB-RKDXNWHRSA-N |
| XLogP | -0.08 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|