C13H23N5O — CID 80683107
N-cyclohexyl-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]acetamide (PubChem CID 80683107) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is N-cyclohexyl-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]acetamide.
| Compound Name | N-cyclohexyl-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]acetamide |
|---|---|
| PubChem CID | 80683107 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | N-cyclohexyl-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]acetamide |
| SMILES | Cn1cnc(CCNCC(=O)NC2CCCCC2)n1 |
| InChI | InChI=1S/C13H23N5O/c1-18-10-15-12(17-18)7-8-14-9-13(19)16-11-5-3-2-4-6-11/h10-11,14H,2-9H2,1H3,(H,16,19) |
| InChIKey | VPUSFKNCIASSNG-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|