C11H21N5 — CID 107911766
2-(1-methyl-1,2,4-triazol-3-yl)-N-(2-pyrrolidin-1-ylethyl)ethanamine (PubChem CID 107911766) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-(1-methyl-1,2,4-triazol-3-yl)-N-(2-pyrrolidin-1-ylethyl)ethanamine.
| Compound Name | 2-(1-methyl-1,2,4-triazol-3-yl)-N-(2-pyrrolidin-1-ylethyl)ethanamine |
|---|---|
| PubChem CID | 107911766 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | 2-(1-methyl-1,2,4-triazol-3-yl)-N-(2-pyrrolidin-1-ylethyl)ethanamine |
| SMILES | Cn1cnc(CCNCCN2CCCC2)n1 |
| InChI | InChI=1S/C11H21N5/c1-15-10-13-11(14-15)4-5-12-6-9-16-7-2-3-8-16/h10,12H,2-9H2,1H3 |
| InChIKey | BJHMBXGWSSMKLT-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|