C8H14N4O2 — CID 80682574
3-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]propanoic acid (PubChem CID 80682574) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 3-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]propanoic acid.
| Compound Name | 3-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]propanoic acid |
|---|---|
| PubChem CID | 80682574 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 3-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]propanoic acid |
| SMILES | Cn1cnc(CCNCCC(=O)O)n1 |
| InChI | InChI=1S/C8H14N4O2/c1-12-6-10-7(11-12)2-4-9-5-3-8(13)14/h6,9H,2-5H2,1H3,(H,13,14) |
| InChIKey | FNUDFYHTXRXICC-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|