C12H21N5O3 — CID 80688771
6-[2-(1-methyl-1,2,4-triazol-3-yl)ethylcarbamoylamino]hexanoic acid (PubChem CID 80688771) has the molecular formula C12H21N5O3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 6-[2-(1-methyl-1,2,4-triazol-3-yl)ethylcarbamoylamino]hexanoic acid.
| Compound Name | 6-[2-(1-methyl-1,2,4-triazol-3-yl)ethylcarbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 80688771 |
| Molecular Formula | C12H21N5O3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 6-[2-(1-methyl-1,2,4-triazol-3-yl)ethylcarbamoylamino]hexanoic acid |
| SMILES | Cn1cnc(CCNC(=O)NCCCCCC(=O)O)n1 |
| InChI | InChI=1S/C12H21N5O3/c1-17-9-15-10(16-17)6-8-14-12(20)13-7-4-2-3-5-11(18)19/h9H,2-8H2,1H3,(H,18,19)(H2,13,14,20) |
| InChIKey | VIMAWCXZRUUTOV-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|