C17H22N4O3 — CID 108812931
6-[(1-methyl-5-phenylpyrazol-3-yl)carbamoylamino]hexanoic acid (PubChem CID 108812931) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 6-[(1-methyl-5-phenylpyrazol-3-yl)carbamoylamino]hexanoic acid.
| Compound Name | 6-[(1-methyl-5-phenylpyrazol-3-yl)carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 108812931 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 6-[(1-methyl-5-phenylpyrazol-3-yl)carbamoylamino]hexanoic acid |
| SMILES | Cn1nc(NC(=O)NCCCCCC(=O)O)cc1-c1ccccc1 |
| InChI | InChI=1S/C17H22N4O3/c1-21-14(13-8-4-2-5-9-13)12-15(20-21)19-17(24)18-11-7-3-6-10-16(22)23/h2,4-5,8-9,12H,3,6-7,10-11H2,1H3,(H,22,23)(H2,18,19,20,24) |
| InChIKey | ILRNJLTUUFNHHK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|