C14H15N5O — CID 108813212
1-(2-cyanoethyl)-3-(1-methyl-5-phenylpyrazol-3-yl)urea (PubChem CID 108813212) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-3-(1-methyl-5-phenylpyrazol-3-yl)urea.
| Compound Name | 1-(2-cyanoethyl)-3-(1-methyl-5-phenylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 108813212 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 1-(2-cyanoethyl)-3-(1-methyl-5-phenylpyrazol-3-yl)urea |
| SMILES | Cn1nc(NC(=O)NCCC#N)cc1-c1ccccc1 |
| InChI | InChI=1S/C14H15N5O/c1-19-12(11-6-3-2-4-7-11)10-13(18-19)17-14(20)16-9-5-8-15/h2-4,6-7,10H,5,9H2,1H3,(H2,16,17,18,20) |
| InChIKey | KWICQYUKBWHFAZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|