C17H14Cl2N4O — CID 108813139
1-(2,6-dichlorophenyl)-3-(1-methyl-5-phenylpyrazol-3-yl)urea (PubChem CID 108813139) has the molecular formula C17H14Cl2N4O and a molecular weight of 361.23 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-3-(1-methyl-5-phenylpyrazol-3-yl)urea.
| Compound Name | 1-(2,6-dichlorophenyl)-3-(1-methyl-5-phenylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 108813139 |
| Molecular Formula | C17H14Cl2N4O |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-3-(1-methyl-5-phenylpyrazol-3-yl)urea |
| SMILES | Cn1nc(NC(=O)Nc2c(Cl)cccc2Cl)cc1-c1ccccc1 |
| InChI | InChI=1S/C17H14Cl2N4O/c1-23-14(11-6-3-2-4-7-11)10-15(22-23)20-17(24)21-16-12(18)8-5-9-13(16)19/h2-10H,1H3,(H2,20,21,22,24) |
| InChIKey | FIXNCIGMGGKUIF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |