C19H19ClN4O3 — CID 108813138
1-(4-chloro-2,5-dimethoxyphenyl)-3-(1-methyl-5-phenylpyrazol-3-yl)urea (PubChem CID 108813138) has the molecular formula C19H19ClN4O3 and a molecular weight of 386.84 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-3-(1-methyl-5-phenylpyrazol-3-yl)urea.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-(1-methyl-5-phenylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 108813138 |
| Molecular Formula | C19H19ClN4O3 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-(1-methyl-5-phenylpyrazol-3-yl)urea |
| SMILES | COc1cc(NC(=O)Nc2cc(-c3ccccc3)n(C)n2)c(OC)cc1Cl |
| InChI | InChI=1S/C19H19ClN4O3/c1-24-15(12-7-5-4-6-8-12)11-18(23-24)22-19(25)21-14-10-16(26-2)13(20)9-17(14)27-3/h4-11H,1-3H3,(H2,21,22,23,25) |
| InChIKey | FTSBHPXSKIDSLE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |