C18H17BrN4O — CID 108813156
1-(4-bromo-3-methylphenyl)-3-(1-methyl-5-phenylpyrazol-3-yl)urea (PubChem CID 108813156) has the molecular formula C18H17BrN4O and a molecular weight of 385.27 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-3-(1-methyl-5-phenylpyrazol-3-yl)urea.
| Compound Name | 1-(4-bromo-3-methylphenyl)-3-(1-methyl-5-phenylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 108813156 |
| Molecular Formula | C18H17BrN4O |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-3-(1-methyl-5-phenylpyrazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)Nc2cc(-c3ccccc3)n(C)n2)ccc1Br |
| InChI | InChI=1S/C18H17BrN4O/c1-12-10-14(8-9-15(12)19)20-18(24)21-17-11-16(23(2)22-17)13-6-4-3-5-7-13/h3-11H,1-2H3,(H2,20,21,22,24) |
| InChIKey | SCEPXUNSPQOAJV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |