C12H20N4O3 — CID 116537348
3,3-dimethyl-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]butanoic acid (PubChem CID 116537348) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is 3,3-dimethyl-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]butanoic acid.
| Compound Name | 3,3-dimethyl-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]butanoic acid |
|---|---|
| PubChem CID | 116537348 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 3,3-dimethyl-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]butanoic acid |
| SMILES | Cn1cnc(CCNC(=O)C(C(=O)O)C(C)(C)C)n1 |
| InChI | InChI=1S/C12H20N4O3/c1-12(2,3)9(11(18)19)10(17)13-6-5-8-14-7-16(4)15-8/h7,9H,5-6H2,1-4H3,(H,13,17)(H,18,19) |
| InChIKey | YMKXKCLVEQEJFL-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|