C7H12N4OS — CID 80686448
N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-2-sulfanylacetamide (PubChem CID 80686448) has the molecular formula C7H12N4OS and a molecular weight of 200.27 g/mol. Its IUPAC name is N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-2-sulfanylacetamide.
| Compound Name | N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-2-sulfanylacetamide |
|---|---|
| PubChem CID | 80686448 |
| Molecular Formula | C7H12N4OS |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-2-sulfanylacetamide |
| SMILES | Cn1cnc(CCNC(=O)CS)n1 |
| InChI | InChI=1S/C7H12N4OS/c1-11-5-9-6(10-11)2-3-8-7(12)4-13/h5,13H,2-4H2,1H3,(H,8,12) |
| InChIKey | BFFPSCHVENHEBP-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|