C8H12ClN5O2 — CID 80689665
2-chloro-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]acetamide (PubChem CID 80689665) has the molecular formula C8H12ClN5O2 and a molecular weight of 245.67 g/mol. Its IUPAC name is 2-chloro-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]acetamide.
| Compound Name | 2-chloro-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]acetamide |
|---|---|
| PubChem CID | 80689665 |
| Molecular Formula | C8H12ClN5O2 |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2-chloro-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl]acetamide |
| SMILES | Cn1cnc(CCNC(=O)NC(=O)CCl)n1 |
| InChI | InChI=1S/C8H12ClN5O2/c1-14-5-11-6(13-14)2-3-10-8(16)12-7(15)4-9/h5H,2-4H2,1H3,(H2,10,12,15,16) |
| InChIKey | IXIOQESYBLMLBS-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|