C9H14N4O2 — CID 80682025
N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-3-oxobutanamide (PubChem CID 80682025) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-3-oxobutanamide.
| Compound Name | N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 80682025 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)NCCc1ncn(C)n1 |
| InChI | InChI=1S/C9H14N4O2/c1-7(14)5-9(15)10-4-3-8-11-6-13(2)12-8/h6H,3-5H2,1-2H3,(H,10,15) |
| InChIKey | YGQJYTAHPNLRSW-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|