C10H16N4 — CID 104807269
N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]pent-3-yn-1-amine (PubChem CID 104807269) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]pent-3-yn-1-amine.
| Compound Name | N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]pent-3-yn-1-amine |
|---|---|
| PubChem CID | 104807269 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]pent-3-yn-1-amine |
| SMILES | CC#CCCNCCc1ncn(C)n1 |
| InChI | InChI=1S/C10H16N4/c1-3-4-5-7-11-8-6-10-12-9-14(2)13-10/h9,11H,5-8H2,1-2H3 |
| InChIKey | CRBYJGWSFGJNOG-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|