C15H22N4 — CID 114333462
N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-4-phenylbutan-1-amine (PubChem CID 114333462) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-4-phenylbutan-1-amine.
| Compound Name | N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-4-phenylbutan-1-amine |
|---|---|
| PubChem CID | 114333462 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-4-phenylbutan-1-amine |
| SMILES | Cn1cnc(CCNCCCCc2ccccc2)n1 |
| InChI | InChI=1S/C15H22N4/c1-19-13-17-15(18-19)10-12-16-11-6-5-9-14-7-3-2-4-8-14/h2-4,7-8,13,16H,5-6,9-12H2,1H3 |
| InChIKey | RGCHGKWWWLLDNF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|