C14H18N4O3 — CID 103258003
2-[2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]ethoxy]benzoic acid (PubChem CID 103258003) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]ethoxy]benzoic acid.
| Compound Name | 2-[2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 103258003 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-[2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]ethoxy]benzoic acid |
| SMILES | Cn1cnc(CCNCCOc2ccccc2C(=O)O)n1 |
| InChI | InChI=1S/C14H18N4O3/c1-18-10-16-13(17-18)6-7-15-8-9-21-12-5-3-2-4-11(12)14(19)20/h2-5,10,15H,6-9H2,1H3,(H,19,20) |
| InChIKey | RDGDHYVWXDYOEZ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|