2-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]benzoic acid

C14H16N2O3 — CID 43532474

IUPAC2-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]benzoic acid
SMILESCc1cc(C)n(CCOc2ccccc2C(=O)O)n1
InChIInChI=1S/C14H16N2O3/c1-10-9-11(2)16(15-10)7-8-19-13-6-4-3-5-12(13)14(17)18/h3-6,9H,7-8H2,1-2H3,(H,17,18)
InChIKeyFUSNIVGDJRKTAK-UHFFFAOYSA-N
MW260.29 g/mol
LogP2.28
Rot. Bonds5

About 2-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]benzoic acid

2-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]benzoic acid (PubChem CID 43532474) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]benzoic acid.

Molecular Properties

Compound Name2-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]benzoic acid
PubChem CID43532474
Molecular FormulaC14H16N2O3
Molecular Weight260.29 g/mol
Exact Mass260.12
IUPAC Name2-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]benzoic acid
SMILESCc1cc(C)n(CCOc2ccccc2C(=O)O)n1
InChIInChI=1S/C14H16N2O3/c1-10-9-11(2)16(15-10)7-8-19-13-6-4-3-5-12(13)14(17)18/h3-6,9H,7-8H2,1-2H3,(H,17,18)
InChIKeyFUSNIVGDJRKTAK-UHFFFAOYSA-N
XLogP2.28
TPSA64.35 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.29
LogP ≤ 52.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]benzoic acid?
The IUPAC name of 2-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]benzoic acid (CID 43532474) is 2-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]benzoic acid.
What is the SMILES notation for 2-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]benzoic acid?
The canonical SMILES for 2-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]benzoic acid is Cc1cc(C)n(CCOc2ccccc2C(=O)O)n1.
What is the InChIKey of 2-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]benzoic acid?
The InChIKey is FUSNIVGDJRKTAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3/c1-10-9-11(2)16(15-10)7-8-19-13-6-4-3-5-12(13)14(17)18/h3-6,9H,7-8H2,1-2H3,(H,17,18).
What are the key properties of 2-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]benzoic acid?
2-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]benzoic acid has a molecular weight of 260.29 g/mol, XLogP of 2.28, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]benzoic acid is sourced from PubChem (CID 43532474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).