C17H22N2O3 — CID 55568167
3-phenoxypropyl 3-(3,5-dimethylpyrazol-1-yl)propanoate (PubChem CID 55568167) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 3-phenoxypropyl 3-(3,5-dimethylpyrazol-1-yl)propanoate.
| Compound Name | 3-phenoxypropyl 3-(3,5-dimethylpyrazol-1-yl)propanoate |
|---|---|
| PubChem CID | 55568167 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 3-phenoxypropyl 3-(3,5-dimethylpyrazol-1-yl)propanoate |
| SMILES | Cc1cc(C)n(CCC(=O)OCCCOc2ccccc2)n1 |
| InChI | InChI=1S/C17H22N2O3/c1-14-13-15(2)19(18-14)10-9-17(20)22-12-6-11-21-16-7-4-3-5-8-16/h3-5,7-8,13H,6,9-12H2,1-2H3 |
| InChIKey | LDVLURRHZDKZPO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|