C16H19ClN2O3 — CID 55562156
2-(3-chlorophenoxy)ethyl 3-(3,5-dimethylpyrazol-1-yl)propanoate (PubChem CID 55562156) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)ethyl 3-(3,5-dimethylpyrazol-1-yl)propanoate.
| Compound Name | 2-(3-chlorophenoxy)ethyl 3-(3,5-dimethylpyrazol-1-yl)propanoate |
|---|---|
| PubChem CID | 55562156 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-(3-chlorophenoxy)ethyl 3-(3,5-dimethylpyrazol-1-yl)propanoate |
| SMILES | Cc1cc(C)n(CCC(=O)OCCOc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C16H19ClN2O3/c1-12-10-13(2)19(18-12)7-6-16(20)22-9-8-21-15-5-3-4-14(17)11-15/h3-5,10-11H,6-9H2,1-2H3 |
| InChIKey | YKNRZHMUGYQXST-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|