C15H17BrN2O3 — CID 55449633
2-(3-bromophenoxy)ethyl 2-(3,5-dimethylpyrazol-1-yl)acetate (PubChem CID 55449633) has the molecular formula C15H17BrN2O3 and a molecular weight of 353.22 g/mol. Its IUPAC name is 2-(3-bromophenoxy)ethyl 2-(3,5-dimethylpyrazol-1-yl)acetate.
| Compound Name | 2-(3-bromophenoxy)ethyl 2-(3,5-dimethylpyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 55449633 |
| Molecular Formula | C15H17BrN2O3 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 2-(3-bromophenoxy)ethyl 2-(3,5-dimethylpyrazol-1-yl)acetate |
| SMILES | Cc1cc(C)n(CC(=O)OCCOc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C15H17BrN2O3/c1-11-8-12(2)18(17-11)10-15(19)21-7-6-20-14-5-3-4-13(16)9-14/h3-5,8-9H,6-7,10H2,1-2H3 |
| InChIKey | IWXXKRJSIDPBLM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|