C11H16N2S — CID 116643984
N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pent-3-yn-1-amine (PubChem CID 116643984) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pent-3-yn-1-amine.
| Compound Name | N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pent-3-yn-1-amine |
|---|---|
| PubChem CID | 116643984 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pent-3-yn-1-amine |
| SMILES | CC#CCCNCCc1scnc1C |
| InChI | InChI=1S/C11H16N2S/c1-3-4-5-7-12-8-6-11-10(2)13-9-14-11/h9,12H,5-8H2,1-2H3 |
| InChIKey | YLSGPAIIRANHHN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|