C13H16N2S — CID 62069916
N-benzyl-2-(4-methyl-1,3-thiazol-5-yl)ethanamine (PubChem CID 62069916) has the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. Its IUPAC name is N-benzyl-2-(4-methyl-1,3-thiazol-5-yl)ethanamine.
| Compound Name | N-benzyl-2-(4-methyl-1,3-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 62069916 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | N-benzyl-2-(4-methyl-1,3-thiazol-5-yl)ethanamine |
| SMILES | Cc1ncsc1CCNCc1ccccc1 |
| InChI | InChI=1S/C13H16N2S/c1-11-13(16-10-15-11)7-8-14-9-12-5-3-2-4-6-12/h2-6,10,14H,7-9H2,1H3 |
| InChIKey | SIANVHBLINKGAN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|