About 2-(4-methyl-1,3-thiazol-5-yl)-N-(pyridazin-3-ylmethyl)ethanamine
2-(4-methyl-1,3-thiazol-5-yl)-N-(pyridazin-3-ylmethyl)ethanamine (PubChem CID 106895634) has the molecular formula C11H14N4S
and a molecular weight of 234.33 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-5-yl)-N-(pyridazin-3-ylmethyl)ethanamine.
Molecular Properties
| Compound Name | 2-(4-methyl-1,3-thiazol-5-yl)-N-(pyridazin-3-ylmethyl)ethanamine |
| PubChem CID | 106895634 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-5-yl)-N-(pyridazin-3-ylmethyl)ethanamine |
| SMILES | Cc1ncsc1CCNCc1cccnn1 |
| InChI | InChI=1S/C11H14N4S/c1-9-11(16-8-13-9)4-6-12-7-10-3-2-5-14-15-10/h2-3,5,8,12H,4,6-7H2,1H3 |
| InChIKey | OWRDFZQHGUCCBU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methyl-1,3-thiazol-5-yl)-N-(pyridazin-3-ylmethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,3-thiazol-5-yl)-N-(pyridazin-3-ylmethyl)ethanamine?
The IUPAC name of 2-(4-methyl-1,3-thiazol-5-yl)-N-(pyridazin-3-ylmethyl)ethanamine (CID 106895634) is 2-(4-methyl-1,3-thiazol-5-yl)-N-(pyridazin-3-ylmethyl)ethanamine.
What is the SMILES notation for 2-(4-methyl-1,3-thiazol-5-yl)-N-(pyridazin-3-ylmethyl)ethanamine?
The canonical SMILES for 2-(4-methyl-1,3-thiazol-5-yl)-N-(pyridazin-3-ylmethyl)ethanamine is Cc1ncsc1CCNCc1cccnn1.
What is the InChIKey of 2-(4-methyl-1,3-thiazol-5-yl)-N-(pyridazin-3-ylmethyl)ethanamine?
The InChIKey is OWRDFZQHGUCCBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4S/c1-9-11(16-8-13-9)4-6-12-7-10-3-2-5-14-15-10/h2-3,5,8,12H,4,6-7H2,1H3.
What are the key properties of 2-(4-methyl-1,3-thiazol-5-yl)-N-(pyridazin-3-ylmethyl)ethanamine?
2-(4-methyl-1,3-thiazol-5-yl)-N-(pyridazin-3-ylmethyl)ethanamine has a molecular weight of 234.33 g/mol, XLogP of 1.57, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,3-thiazol-5-yl)-N-(pyridazin-3-ylmethyl)ethanamine is sourced from PubChem (CID 106895634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).