C14H20N4S — CID 63836860
N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]-N-(pyridin-2-ylmethyl)ethane-1,2-diamine (PubChem CID 63836860) has the molecular formula C14H20N4S and a molecular weight of 276.41 g/mol. Its IUPAC name is N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]-N-(pyridin-2-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]-N-(pyridin-2-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 63836860 |
| Molecular Formula | C14H20N4S |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N'-methyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]-N-(pyridin-2-ylmethyl)ethane-1,2-diamine |
| SMILES | Cc1ncsc1CN(C)CCNCc1ccccn1 |
| InChI | InChI=1S/C14H20N4S/c1-12-14(19-11-17-12)10-18(2)8-7-15-9-13-5-3-4-6-16-13/h3-6,11,15H,7-10H2,1-2H3 |
| InChIKey | ARMZPNVDARLWFZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|