C11H17N5S — CID 55201331
2-(4-methyl-1,3-thiazol-5-yl)-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]ethanamine (PubChem CID 55201331) has the molecular formula C11H17N5S and a molecular weight of 251.36 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-5-yl)-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]ethanamine.
| Compound Name | 2-(4-methyl-1,3-thiazol-5-yl)-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 55201331 |
| Molecular Formula | C11H17N5S |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-5-yl)-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]ethanamine |
| SMILES | Cc1ncsc1CCNCCc1nncn1C |
| InChI | InChI=1S/C11H17N5S/c1-9-10(17-8-13-9)3-5-12-6-4-11-15-14-7-16(11)2/h7-8,12H,3-6H2,1-2H3 |
| InChIKey | UZRCBOGVWVXEOD-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|