C12H17N3S2 — CID 106045272
2-(2-methyl-1,3-thiazol-4-yl)-N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]ethanamine (PubChem CID 106045272) has the molecular formula C12H17N3S2 and a molecular weight of 267.42 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-4-yl)-N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]ethanamine.
| Compound Name | 2-(2-methyl-1,3-thiazol-4-yl)-N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 106045272 |
| Molecular Formula | C12H17N3S2 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-4-yl)-N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]ethanamine |
| SMILES | Cc1nc(CCNCCc2scnc2C)cs1 |
| InChI | InChI=1S/C12H17N3S2/c1-9-12(17-8-14-9)4-6-13-5-3-11-7-16-10(2)15-11/h7-8,13H,3-6H2,1-2H3 |
| InChIKey | JUBJSBNGYPYJDB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|