C13H14F2N2S — CID 55237246
N-[(2,5-difluorophenyl)methyl]-2-(4-methyl-1,3-thiazol-5-yl)ethanamine (PubChem CID 55237246) has the molecular formula C13H14F2N2S and a molecular weight of 268.33 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-2-(4-methyl-1,3-thiazol-5-yl)ethanamine.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-2-(4-methyl-1,3-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 55237246 |
| Molecular Formula | C13H14F2N2S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-2-(4-methyl-1,3-thiazol-5-yl)ethanamine |
| SMILES | Cc1ncsc1CCNCc1cc(F)ccc1F |
| InChI | InChI=1S/C13H14F2N2S/c1-9-13(18-8-17-9)4-5-16-7-10-6-11(14)2-3-12(10)15/h2-3,6,8,16H,4-5,7H2,1H3 |
| InChIKey | RPJAMFJXFILTJT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|