C12H11F3N2S — CID 62809929
3,4,5-trifluoro-N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]aniline (PubChem CID 62809929) has the molecular formula C12H11F3N2S and a molecular weight of 272.30 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]aniline.
| Compound Name | 3,4,5-trifluoro-N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]aniline |
|---|---|
| PubChem CID | 62809929 |
| Molecular Formula | C12H11F3N2S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 3,4,5-trifluoro-N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]aniline |
| SMILES | Cc1ncsc1CCNc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H11F3N2S/c1-7-11(18-6-17-7)2-3-16-8-4-9(13)12(15)10(14)5-8/h4-6,16H,2-3H2,1H3 |
| InChIKey | KRXXDDKRDOKBRH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|