C14H16F2N4S — CID 111903389
1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine (PubChem CID 111903389) has the molecular formula C14H16F2N4S and a molecular weight of 310.37 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111903389 |
| Molecular Formula | C14H16F2N4S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1cc(F)ccc1F)NCc1scnc1C |
| InChI | InChI=1S/C14H16F2N4S/c1-9-13(21-8-20-9)7-19-14(17-2)18-6-10-5-11(15)3-4-12(10)16/h3-5,8H,6-7H2,1-2H3,(H2,17,18,19) |
| InChIKey | RYRJBRDKFUPTAM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|